|
|
| | 1-BroMo-2,4-difluoro-3-nitrobenzene Basic information |
| Product Name: | 1-BroMo-2,4-difluoro-3-nitrobenzene | | Synonyms: | 1-BroMo-2,4-difluoro-3-nitrobenzene;3-Bromo-2,6-difluoronitrobenzene 97%;3-Bromo-2,6-difluoronitrobenzene97%;OZKHXLKTMAVPFF-UHFFFAOYSA-N;3-Bromo-2,6-difluoronitrobenzene;Benzene, 1-bromo-2,4-difluoro-3-nitro- | | CAS: | 1420800-30-1 | | MF: | C6H2BrF2NO2 | | MW: | 237.99 | | EINECS: | | | Product Categories: | | | Mol File: | 1420800-30-1.mol |  |
| | 1-BroMo-2,4-difluoro-3-nitrobenzene Chemical Properties |
| Boiling point | 260.8±35.0 °C(Predicted) | | density | 1.890±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | form | liquid | | color | Clear, faint lime/lemon | | InChI | InChI=1S/C6H2BrF2NO2/c7-3-1-2-4(8)6(5(3)9)10(11)12/h1-2H | | InChIKey | OZKHXLKTMAVPFF-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(F)C([N+]([O-])=O)=C1F |
| | 1-BroMo-2,4-difluoro-3-nitrobenzene Usage And Synthesis |
| | 1-BroMo-2,4-difluoro-3-nitrobenzene Preparation Products And Raw materials |
|