|
|
| | 2-PentanaMine, hydrochloride (1:1), (2S)- Basic information |
| Product Name: | 2-PentanaMine, hydrochloride (1:1), (2S)- | | Synonyms: | (2S)-Pentanamine hydrochloride;2-PentanaMine, hydrochloride (1:1), (2S)-;(2S)-pentan-2-amine hydrochloride;(S)-Pentan-2-amine hydrochloride;(2S)-2-Pentanamine Hydrochloride;(S)-pentan-2-amine HCl | | CAS: | 216237-52-4 | | MF: | C5H13N.ClH | | MW: | 123.62 | | EINECS: | | | Product Categories: | | | Mol File: | 216237-52-4.mol |  |
| | 2-PentanaMine, hydrochloride (1:1), (2S)- Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | solubility | Ethanol (Sparingly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Pale Grey | | InChI | InChI=1/C5H13N.ClH/c1-3-4-5(2)6;/h5H,3-4,6H2,1-2H3;1H/t5-;/s3 | | InChIKey | AMIBHXGATODRDN-USHJBNIQNA-N | | SMILES | Cl.N[C@@H](C)CCC |&1:2,r| |
| | 2-PentanaMine, hydrochloride (1:1), (2S)- Usage And Synthesis |
| | 2-PentanaMine, hydrochloride (1:1), (2S)- Preparation Products And Raw materials |
|