|
|
| | 5-phenyl-5,12- dihydroindolo [3,2-a]carbazole Basic information |
| Product Name: | 5-phenyl-5,12- dihydroindolo [3,2-a]carbazole | | Synonyms: | 5,12-Dihydro-5-phenylindolo[3,2-a]carbazole;5-phenyl-5,12- dihydroindolo [3,2-a]carbazole;Indolo[3,2-a]carbazole, 5,12-dihydro-5-phenyl-;4-PCI;5-phenyl-5,12- dihydroindolo [3,2-a]carbazole
diyl)-3,3’-m-terphenyl;5-Phenyl-5,12-dihydroindole[3,2-a]carbazole;5-phenyl-5,12-dihydroindolebenzo[3,2-A]carbazole | | CAS: | 1247053-55-9 | | MF: | C24H16N2 | | MW: | 332.4 | | EINECS: | | | Product Categories: | OLED | | Mol File: | 1247053-55-9.mol | ![5-phenyl-5,12- dihydroindolo [3,2-a]carbazole Structure](CAS/20180808/GIF/1247053-55-9.gif) |
| | 5-phenyl-5,12- dihydroindolo [3,2-a]carbazole Chemical Properties |
| Melting point | 170 °C | | Boiling point | 598.8±32.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 16.87±0.30(Predicted) | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C24H16N2/c1-2-8-16(9-3-1)26-21-13-7-5-11-19(21)23-22(26)15-14-18-17-10-4-6-12-20(17)25-24(18)23/h1-15,25H | | InChIKey | NIYSSWKVTXONEP-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C2=C1C1C3=C(N(C4=CC=CC=C4)C=1C=C2)C=CC=C3 |
| | 5-phenyl-5,12- dihydroindolo [3,2-a]carbazole Usage And Synthesis |
| Chemical Properties | off-white powder |
| | 5-phenyl-5,12- dihydroindolo [3,2-a]carbazole Preparation Products And Raw materials |
|