| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| Product Name: | CarbaMic acid, N,N-di-2-propyn-1-yl-, 1,1-diMethylethyl ester | | Synonyms: | CarbaMic acid, N,N-di-2-propyn-1-yl-, 1,1-diMethylethyl ester;N-Boc-dipropargylamine;2-Methyl-2-propanyl di-2-propyn-1-ylcarbamate;Carbamic acid, di-2-propynyl-, 1,1-dimethylethyl ester (9CI);tert-Butyl diprop-2-ynylcarbamate;N-Boc-N-(2-propyn-1-yl)-2-propyn-1-amine;tert-butyl N,N-bis(prop-2-ynyl)carbamate;N-tertbutyloxycarbonyldiynepropylamine | | CAS: | 262418-92-8 | | MF: | C11H15NO2 | | MW: | 193.24 | | EINECS: | | | Product Categories: | | | Mol File: | 262418-92-8.mol |  |
| | CarbaMic acid, N,N-di-2-propyn-1-yl-, 1,1-diMethylethyl ester Chemical Properties |
| Boiling point | 247.9±33.0 °C(Predicted) | | density | 1.025±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | -2.18±0.70(Predicted) | | Appearance | White to yellow Liquid | | InChI | InChI=1S/C11H15NO2/c1-6-8-12(9-7-2)10(13)14-11(3,4)5/h1-2H,8-9H2,3-5H3 | | InChIKey | BPKHWXYPEWXEAL-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)N(CC#C)CC#C |
| | CarbaMic acid, N,N-di-2-propyn-1-yl-, 1,1-diMethylethyl ester Usage And Synthesis |
| Application | N-Boc-dipropyne can be used as an organic synthesis intermediate and a pharmaceutical intermediate in laboratory research and development processes and in the synthesis of pharmaceutical chemicals. | | Application | N-Boc-dipropyne can be used as an organic synthesis intermediate and a pharmaceutical intermediate in laboratory research and development processes and in the synthesis of pharmaceutical chemicals. |
| | CarbaMic acid, N,N-di-2-propyn-1-yl-, 1,1-diMethylethyl ester Preparation Products And Raw materials |
|