| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
8-Methylquinoline N-oxide manufacturers
|
| | 8-Methylquinoline N-oxide Basic information |
| Product Name: | 8-Methylquinoline N-oxide | | Synonyms: | 8-Methylquinoline N-oxide;8-methylquinoline 1-oxide;Quinoline, 8-methyl-, 1-oxide;8-methyl-1-oxidoquinolin-1-ium;Methdilazine Impurity 2;8-Methylquinoline N-oxide | | CAS: | 4053-38-7 | | MF: | C10H9NO | | MW: | 159.18 | | EINECS: | | | Product Categories: | | | Mol File: | 4053-38-7.mol |  |
| | 8-Methylquinoline N-oxide Chemical Properties |
| Melting point | 240-260°C | | Boiling point | 315.0±35.0 °C(Predicted) | | density | 1.10±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 1.08±0.30(Predicted) | | form | solid | | InChI | 1S/C10H9NO/c1-8-4-2-5-9-6-3-7-11(12)10(8)9/h2-7H,1H3 | | InChIKey | PIOGDSHYODXWAK-UHFFFAOYSA-N | | SMILES | [O-][N+]1=CC=CC2=C1C(C)=CC=C2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 8-Methylquinoline N-oxide Usage And Synthesis |
| Reactions | A Pd(II)-catalyzed regioselective dual C(sp3)–H/C7(sp2)–H activation and annulation of 8-methylquinoline N-oxides with maleimide has been accomplished[1]. The use of N-oxide as a weak directing group under Pd(II)-complex catalysis activates the initial C(sp3)–H and triggers a relayed, second C7(sp2)–H activation. The dual C–H bond activation, [3 + 2]-annulation, facile introduction and removal of the directing group, substrate scope, and functional group diversity are the important practical features.
 | | References | [1] Dual C(sp3)–H and C(sp2)–H Activation of 8-Methylquinoline N-Oxides: A Route to Access C7–H Bond. DOI:10.1021/acs.orglett.4c02584
|
| | 8-Methylquinoline N-oxide Preparation Products And Raw materials |
|