|
|
| | Altenuene Basic information |
| Product Name: | Altenuene | | Synonyms: | (2-alpha,3-beta,4a-beta)-(+-)-ethyl;6h-dibenzo(b,d)pyran-6-one,2,3,4,4a-tetrahydro-2,3,7-trihydroxy-9-methoxy-4a-m;altenuene from alternaria sp.;(2R,3R,4aR)-2,3,7-trihydroxy-9-methoxy-4a-methyl-3,4-dihydro-2H-benzo[c]chromen-6-one;6H-Dibenzo[b,d]pyran-6-one, 2,3,4,4a-tetrahydro-2,3,7-trihydroxy-9-methoxy-4a-methyl-, (2R,3R,4aR)-rel-;Altenuene
Discontinued. Please see A575740.;(2S,3S,4aS)-2,3,7-trihydroxy-9-methoxy-4a-methyl-3,4-dihydro-2H-benzo[c]chromen-6-one;Altenuene in Methanol | | CAS: | 29752-43-0 | | MF: | C15H16O6 | | MW: | 292.28 | | EINECS: | | | Product Categories: | Cell Signaling and Neuroscience;Mold;Toxins and Venoms | | Mol File: | 29752-43-0.mol |  |
| | Altenuene Chemical Properties |
| Boiling point | 609.386±55.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.496±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C | | form | Solid | | pka | 7.412±0.70(predicted) | | color | White to off-white | | Major Application | food and beverages | | InChI | InChI=1/C15H16O6/c1-15-6-12(18)10(16)5-9(15)8-3-7(20-2)4-11(17)13(8)14(19)21-15/h3-5,10,12,16-18H,6H2,1-2H3/t10-,12-,15-/s3 | | InChIKey | MMHTXEATDNFMMY-BSZOFMBKNA-N | | SMILES | [C@@]12(C)C[C@@H](O)[C@H](O)C=C1C1=CC(OC)=CC(O)=C1C(=O)O2 |&1:0,3,5,r| |
| Hazard Codes | T+ | | Risk Statements | 61-26/27/28 | | Safety Statements | 53-36/37/39-45 | | RIDADR | UN 2811 6.1/PG 2 | | WGK Germany | 3 | | RTECS | HP8758000 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Flam. Liq. 2 |
| | Altenuene Usage And Synthesis |
| Uses | Altenuene is a heptaketide isolated from an endolichenic fungal strain Nigrospora sphaerica[1]. | | References | [1] He JW, et al. Heptaketides with antiviral activity from three endolichenic fungal strains Nigrospora sp., Alternaria sp. and Phialophora sp. Fitoterapia. 2012 Sep;83(6):1087-91. DOI:10.1016/j.fitote.2012.05.002 |
| | Altenuene Preparation Products And Raw materials |
|