| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | L-Leucine beta-naphthylamide Basic information |
| Product Name: | L-Leucine beta-naphthylamide | | Synonyms: | leucine-beta-naphthylamide;L-LEUCINE-2-NAPHTHYLAMIDE;LEUCINE-BETANA;L-leucine B-naphthylamide free base;(S)-2-amino-4-methyl-N-2-naphthylvaleramide;l-leucine β-naphthylamide;H-Leu-bNA;(S)-2-Amino-4-methyl-N-(2-naphthalenyl)pentanamide | | CAS: | 732-85-4 | | MF: | C16H20N2O | | MW: | 256.34 | | EINECS: | 2119900 | | Product Categories: | | | Mol File: | 732-85-4.mol |  |
| | L-Leucine beta-naphthylamide Chemical Properties |
| storage temp. | -20°C | | solubility | H2O: insoluble | | form | powder | | Water Solubility | H2O: insoluble | | InChI | 1S/C16H20N2O/c1-11(2)9-15(17)16(19)18-14-8-7-12-5-3-4-6-13(12)10-14/h3-8,10-11,15H,9,17H2,1-2H3,(H,18,19)/t15-/m0/s1 | | InChIKey | JWHURRLUBVMKOT-HNNXBMFYSA-N | | SMILES | CC(C)C[C@H](N)C(=O)Nc1ccc2ccccc2c1 |
| Hazard Codes | Xn | | Risk Statements | 40 | | Safety Statements | 22-36 | | WGK Germany | 3 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Carc. 2 |
| | L-Leucine beta-naphthylamide Usage And Synthesis |
| Uses | L-Leucine-β-naphthylamide is used in the synthesis of protein tyrosine phosphatase inhibitors. Used as an agent to combat Leishmania major. | | Uses | L-Leucine β-naphthylamide has been used as a substrate:
- to measure the activity of aminopeptidase in Escherichia coli
- to evaluate the enzyme activity of cathepsin H from rabbit skeletal muscles
- in the proteolytic assay of L-Leucine aminopeptidase
| | Definition | ChEBI: An L-leucine derivative that is the amide obtained by formal condensation of the carboxy group of L-leucine with the amino group of 2-naphthylamine. |
| | L-Leucine beta-naphthylamide Preparation Products And Raw materials |
|