| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
2,6-Bis(trifluoromethyl)benzoic acid manufacturers
|
| | 2,6-Bis(trifluoromethyl)benzoic acid Basic information |
| | 2,6-Bis(trifluoromethyl)benzoic acid Chemical Properties |
| Melting point | 138-140 °C (lit.) | | Boiling point | 220℃ | | density | 1.527 | | Fp | 87℃ | | storage temp. | Store at room temperature | | form | Crystalline Powder | | pka | 2.27±0.50(Predicted) | | color | White | | Water Solubility | Soluble in water. | | BRN | 2057459 | | InChI | 1S/C9H4F6O2/c10-8(11,12)4-2-1-3-5(9(13,14)15)6(4)7(16)17/h1-3H,(H,16,17) | | InChIKey | XZNLSDPNMNWCRE-UHFFFAOYSA-N | | SMILES | OC(=O)c1c(cccc1C(F)(F)F)C(F)(F)F | | CAS DataBase Reference | 24821-22-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,6-Bis(trifluoromethyl)benzoic acid Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | 2,6-Bis(trifluoromethyl)benzoic acid is a useful synthetic intermediate, and is a derivative of Benzoic acid (B203900). 2,6-Bis(trifluoromethyl)benzoic acid has also been identified as a chemical hybridizing agent in wheat. |
| | 2,6-Bis(trifluoromethyl)benzoic acid Preparation Products And Raw materials |
|