|
|
| | D-4-Fluorophenylalanine hydrochloride Basic information |
| | D-4-Fluorophenylalanine hydrochloride Chemical Properties |
| Melting point | 245 °C (dec.)(lit.) | | alpha | 11 º (c=1, H2O) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | color | white | | Optical Rotation | [α]23/D +11°, c = 1 in H2O | | Major Application | peptide synthesis | | InChI | 1S/C9H10FNO2.ClH/c10-7-3-1-6(2-4-7)5-8(11)9(12)13;/h1-4,8H,5,11H2,(H,12,13);1H/t8-;/m1./s1 | | InChIKey | ZDECBCKSULAIGP-DDWIOCJRSA-N | | SMILES | Cl.N[C@H](Cc1ccc(F)cc1)C(O)=O | | CAS DataBase Reference | 122839-52-5(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | D-4-Fluorophenylalanine hydrochloride Usage And Synthesis |
| Uses | D-4-Fluorophenylalanine hydrochloride is mainly used as an amino acid derivative in medicine and biochemical research. |
| | D-4-Fluorophenylalanine hydrochloride Preparation Products And Raw materials |
|