|
|
| | E-Maleimidopropionic acid hydrazide Basic information |
| Product Name: | E-Maleimidopropionic acid hydrazide | | Synonyms: | 3-Maleimidopropionic acid hydrazide;3-Maleimidopropionic acid hydrazide hydrochloride;1H-Pyrrole-1-propanoic acid, 2,5-dihydro-2,5-dioxo-, hydrazide;3-(2,5-dioxopyrrol-1-yl)propanehydrazide;3-(2,5-DIOXO-2,5-DIHYDRO-1H-PYRROL-1-YL)PROPANEHYDRAZIDE;E-Maleimidopropionic acid hydrazide | | CAS: | 359436-60-5 | | MF: | C7H9N3O3 | | MW: | 183.16 | | EINECS: | | | Product Categories: | | | Mol File: | 359436-60-5.mol |  |
| | E-Maleimidopropionic acid hydrazide Chemical Properties |
| Boiling point | 468.4±28.0 °C(Predicted) | | density | 1.411±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 12.84±0.35(Predicted) | | InChI | InChI=1S/C7H9N3O3/c8-9-5(11)3-4-10-6(12)1-2-7(10)13/h1-2H,3-4,8H2,(H,9,11) | | InChIKey | PATQAHLJQRPGRQ-UHFFFAOYSA-N | | SMILES | N1(CCC(NN)=O)C(=O)C=CC1=O |
| | E-Maleimidopropionic acid hydrazide Usage And Synthesis |
| Uses | carbonyl and sulfhydryl reactive heterobifunctional cross-linking reagent |
| | E-Maleimidopropionic acid hydrazide Preparation Products And Raw materials |
|