| Company Name: |
Suzhou Victorypharm Co.,Ltd.
|
| Tel: |
512-68242903 13916956214 |
| Email: |
sales@victory-pharm.com |
| Products Intro: |
Product Name:1-(4-bromophenyl)azetidin-2-one
CAS:7661-25-8
Purity:99% HPLC Package:100G;1KG;25KG
|
1-(4-bromophenyl)azetidin-2-one manufacturers
|
| | 1-(4-bromophenyl)azetidin-2-one Basic information |
| | 1-(4-bromophenyl)azetidin-2-one Chemical Properties |
| Melting point | 126-127 °C | | Boiling point | 417.3±28.0 °C(Predicted) | | density | 1.72 g/cm3 | | pka | -0.48±0.20(Predicted) | | InChI | InChI=1S/C9H8BrNO/c10-7-1-3-8(4-2-7)11-6-5-9(11)12/h1-4H,5-6H2 | | InChIKey | OWNBBRYHFWKSFA-UHFFFAOYSA-N | | SMILES | N1(C2=CC=C(Br)C=C2)CCC1=O |
| | 1-(4-bromophenyl)azetidin-2-one Usage And Synthesis |
| Uses | 1-(4-bromophenyl)azetidin-2-one is mainly used in organic synthesis and pharmaceutical synthesis.
| | Structure and conformation | Crystals of the 1-(4-bromophenyl)azetidin-2-one are monoclinic with a= 10·175, b= 7·403, c= 11·804 Å, β= 99·8° space group P21/a, with Z= 4.[1] | | References | [1] Kartha, G., & Ambady, G. (1973). Crystal and molecular structure of 1-(4-bromophenyl)azetidin-2-one. Journal of the Chemical Society Perkin Transactions 2, 15, 2042. https://doi.org/10.1039/p29730002042
|
| | 1-(4-bromophenyl)azetidin-2-one Preparation Products And Raw materials |
|