| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
RYSS TECH LTD |
| Tel: |
400-188-0725 +86 21 34310725 13611771617 |
| Email: |
|
4-Decanol manufacturers
- Decan-4-ol
-
- $2.20
-
2026-08-25
- CAS:2051-31-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 50kg
- 4-Decanol
-
- $29.00
-
2026-07-20
- CAS:2051-31-2
- Purity: 99.41%
- Supply Ability: 10g
- 4-DECANOL
-
-
2024-03-28
- CAS:2051-31-2
- Min. Order: 25KG
- Purity: ≥95%
|
| | 4-Decanol Basic information |
| Product Name: | 4-Decanol | | Synonyms: | 4-DECYL ALCOHOL;4-DECANOL, 97+%;Hexylpropylcarbinol;Decane-4-ol;4-Decanol,99%;4-Decyl Alcohol
Hexylpropylcarbinol;1-Propylheptyl alcohol;Decanol-4 | | CAS: | 2051-31-2 | | MF: | C10H22O | | MW: | 158.28 | | EINECS: | 218-117-2 | | Product Categories: | | | Mol File: | 2051-31-2.mol |  |
| | 4-Decanol Chemical Properties |
| Melting point | -11.4°C | | Boiling point | 210-211 °C | | density | 0.82 | | refractive index | 1.431-1.433 | | Fp | 82 °C | | pka | 15.44±0.20(Predicted) | | form | clear liquid | | color | Colorless to Light yellow | | BRN | 1735252 | | Henry's Law Constant | 3.8×10-2 mol/(m3Pa) at 25℃, Yaws (2003) | | InChI | InChI=1S/C10H22O/c1-3-5-6-7-9-10(11)8-4-2/h10-11H,3-9H2,1-2H3 | | InChIKey | DTDMYWXTWWFLGJ-UHFFFAOYSA-N | | SMILES | CCCC(O)CCCCCC | | LogP | 3.740 (est) | | CAS DataBase Reference | 2051-31-2(CAS DataBase Reference) |
| | 4-Decanol Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS LIQUID | | Uses | 4-Decanol is an antimutagenic compound, that can be isolated from mustard leaves. 4-Decanol inhibits mutagenic activities of Aflatoxin B1 (HY-N6615) and MNNG (HY-128612) in Salmonella typhimurium TA100[1][2]. | | References | [1] Mahmood, U., et al. (2004). Volatile constituents of Capillipedium parviflorum. Phytochemistry, 65(14), 2163–2166. [2] Kim J O , et al.Antimutagenic effects of 4-decanol identified from mustard leaf. Applied Biological Chemistry, 1993, 36:424-427. |
| | 4-Decanol Preparation Products And Raw materials |
|