|
|
| | Benzenemethanamine,N-(1-methylethyl)-, hydrochloride (1:1) Basic information |
| | Benzenemethanamine,N-(1-methylethyl)-, hydrochloride (1:1) Chemical Properties |
| Melting point | 195 °C | | solubility | DMF: 15 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml; PBS (pH 7.2): 10 mg/ml | | form | A crystalline solid | | InChI | InChI=1S/C10H15N.ClH/c1-9(2)11-8-10-6-4-3-5-7-10;/h3-7,9,11H,8H2,1-2H3;1H | | InChIKey | PEIJPMBOGRPKQJ-UHFFFAOYSA-N | | SMILES | CC(NCC1=CC=CC=C1)C.[H]Cl |
| | Benzenemethanamine,N-(1-methylethyl)-, hydrochloride (1:1) Usage And Synthesis |
| Description | N-Isopropylbenzylamine (hydrochloride) is an analytical reference standard categorized as an adulterant.1 N-Isopropylbenzylamine has been found as an adulterant and methamphetamine mimic in samples seized by law enforcement. This product is intended for research and forensic applications. | | Uses | N-Isopropylbenzylamine hydrochloride is a biomolecule. | | References | 1. Sanderson, R.M. Identification of N-methylbenzylamine hydrochloride, N-ethylbenzylamine hydrochloride, and N-isopropylbenzylamine hydrochloride Microgram J. 6(1-2),36-45(2008). |
| | Benzenemethanamine,N-(1-methylethyl)-, hydrochloride (1:1) Preparation Products And Raw materials |
|