|
|
| | Cyanine7.5 azide Basic information |
| Product Name: | Cyanine7.5 azide | | Synonyms: | Cyanine7.5 azide;Cy7.5 azide;Cy7.5 N3;Cyanine7.5 azide chloride;(2R,3R,4R,5R)-2-((bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-4-(methoxy-d3)tetrahydrofuran-3-yl (2-cyanoethyl) diisopropylphosphoramidite | | CAS: | 1628790-36-2 | | MF: | C48H55ClN6O | | MW: | 767.46 | | EINECS: | | | Product Categories: | | | Mol File: | 1628790-36-2.mol |  |
| | Cyanine7.5 azide Chemical Properties |
| solubility | Soluble in DMSO, DMF, DCM | | form | powder | | Appearance | Green solid | | ex/em | 784/814 nm (PBS buffer) | | ε(extinction coefficient) | 223000 L⋅mol−1⋅cm−1 | | Φ(quantum yield) | 0.10 | | SMILES | [Cl-].CN1\C(=C\C=C\C=C\C=C\C2=[N+](CCCCCC(=O)NCCCN=[N+]=[N-])c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| | Cyanine7.5 azide Usage And Synthesis |
| Description | Cyanine7.5 is a NIR dye with long-wave infrared fluorescence. This derivative is azide for click chemistry.
Can be used for the construction of various labeled biomolecules containing Cyanine7.5, near-infrared fluorescent dye, and an improved analog of Cy7.5®. These conjugates can take advantage of NIR tissue transparency when used for in vivo imaging. This fluorophore is also useful for other fluorescent applications, especially requiring low fluorescent background.
Azide is available as a DMSO solution, ready for general click chemistry labeling protocol, or in solid form for custom labeling applications.
Structure features a rigid bridged polymethine chain to increase quantum yield by 20%, allowing for a brighter signal. | | Chemical Properties | Appearance: Green solid
ex/em: 784/814 nm (PBS buffer)
Extinction coefficient (ε): 223000 Lmol1cm1
Quantum yield (Φ): 0.10 | | Uses | Cyanine7.5 azide chloride is a dye derivative of Cyanine 7.5 (Cy7.5) (HY-D0926) with an azide functional group. Cy7.5 is a near-infrared fluorescent dye commonly used for biolabeling and cell imaging. The azide group of Cyanine7.5 azide chloride can react chemically with molecules containing alkyne functionality, such as alkyne or cyclooctyne, to form covalent bonds. Therefore, Cyanine7.5 azide chloride can bind to biomolecules such as proteins and antibodies to track their location and dynamic changes in biological samples. | | Abs/Em Maxima | 788/808 nm | | Fluoresene quantum yield | 0.1 | | Extinction Coefficient | 223000 |
| | Cyanine7.5 azide Preparation Products And Raw materials |
|