| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
13636370518 |
| Email: |
shyysw007@163.com |
| Products Intro: |
Product Name:Cy7.5 carboxylic acid
CAS:1686147-68-1
Purity:95% Package:25mg Remarks:S53896
|
| Company Name: |
Zhengzhou Acme Chemical Co., Ltd.
|
| Tel: |
0371-0371-55629727 13323845623 |
| Email: |
2885676761@qq.com |
| Products Intro: |
CAS:1686147-68-1
Purity:98% HPLC Package:25g;100g;500g
|
Cyanine7.5 carboxylic acid manufacturers
|
| | Cyanine7.5 carboxylic acid Basic information |
| Product Name: | Cyanine7.5 carboxylic acid | | Synonyms: | Cyanine7.5 carboxylic acid;Cy7.5 carboxylic acid;Cyanine7.5 carboxylic acid,Cy7.5COOH;Cyanine7.5 carboxylic acid (Cyclohexene);RMA-274;CY7.5-COOH;CY7.5-COOH/ICG-COOH | | CAS: | 1686147-68-1 | | MF: | C45H48N2O2 | | MW: | 648.89 | | EINECS: | | | Product Categories: | | | Mol File: | 1686147-68-1.mol |  |
| | Cyanine7.5 carboxylic acid Chemical Properties |
| solubility | Soluble in organic solvents such as DMF | | Appearance | Green solid | | ex/em | 784/814nm (MeOH/PBS buffer) | | ε(extinction coefficient) | 223000 L⋅mol−1⋅cm−1 | | Φ(quantum yield) | 0.10 | | InChIKey | DIOYUGMHQUIXFB-UHFFFAOYSA-N | | SMILES | CC1(C(N(CCCCCC(=O)[O-])C2C=CC3=CC=CC=C3C1=2)=CC=C1CCCC(C=CC2=[N+](C3C=CC4=CC=CC=C4C=3C2(C)C)C)=C1)C |
| | Cyanine7.5 carboxylic acid Usage And Synthesis |
| Description | Free unactivated Cyanine7.5 NIR dye carboxylic acid.
For coupling and labeling reactions also consider using pre-activated Cyanine7.5 NHS ester. | | Chemical Properties | Appearance: Green solid
ex/em: 784/814nm (MeOH/PBS buffer)
Extinction coefficient (ε): 223000 Lmol1cm1
Quantum yield (Φ): 0.10 | | Uses | Cyanine7.5 carboxylic is a dye derivative of Cyanine 7.5 (Cy7.5) (HY-D0926) with carboxylic acid functional groups. Cy7.5 is a near-infrared fluorescent dye commonly used in biomedical research areas such as biomarkers and cell imaging. Cyanine7.5 carboxylic can be covalently bound to some biological molecules (especially antibodies, proteins, etc.) to track their location and dynamic changes in biological samples. | | Abs/Em Maxima | 788/808 nm | | Fluoresene quantum yield | 0.1 | | Extinction Coefficient | 223000 |
| | Cyanine7.5 carboxylic acid Preparation Products And Raw materials |
|