|
|
| | 2-ACETYL-3-AMINOTHIOPHENE Basic information |
| Product Name: | 2-ACETYL-3-AMINOTHIOPHENE | | Synonyms: | BUTTPARK 85\18-13;2-ACETYL-3-AMINOTHIOPHENE;1-(5-Amino-2-thienyl)ethanone;2-acetylthiophene-3-amine;1-(3-AMINO-2-THIENYL)ETHAN-1-ONE;1-(3-Aminothien-2-yl)ethan-1-one;1-(3-aMinothiophen-2-yl)ethan-1-one;1-(3-AMinothiophen-2-yl)ethanone | | CAS: | 31968-33-9 | | MF: | C6H7NOS | | MW: | 141.19 | | EINECS: | | | Product Categories: | Thiophenes | | Mol File: | 31968-33-9.mol |  |
| | 2-ACETYL-3-AMINOTHIOPHENE Chemical Properties |
| Melting point | 84-88°C | | Boiling point | 120-125°C 0,8mm | | Fp | 120-125°C/0.8mm | | storage temp. | 2-8°C | | form | crystalline solid | | color | Off-white | | Water Solubility | Insoluble in water. | | BRN | 1635973 | | InChI | InChI=1S/C6H7NOS/c1-4(8)6-5(7)2-3-9-6/h2-3H,7H2,1H3 | | InChIKey | MMLSKDGCLMDHAJ-UHFFFAOYSA-N | | SMILES | C(=O)(C1SC=CC=1N)C | | CAS DataBase Reference | 31968-33-9(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 20/21/22-36-22 | | Safety Statements | 22-36/37-26 | | WGK Germany | 3 | | Hazard Note | Irritant | | PackingGroup | III | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| Provider | Language |
|
ALFA
| English |
| | 2-ACETYL-3-AMINOTHIOPHENE Usage And Synthesis |
| Uses | Dithienopyridines was synthesised from 2-Acetyl-3-aminothiophene. Also used as fine Intermediate. |
| | 2-ACETYL-3-AMINOTHIOPHENE Preparation Products And Raw materials |
|