| Company Name: |
Henan Tianfu Chemical Co.,Ltd. |
| Tel: |
+86-0371-55170693 +86-19937530512 |
| Email: |
info@tianfuchem.com |
| Products Intro: |
Product Name:Decanoic acid,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro- CAS:335-76-2 Purity:99% Package:25KG;5KG;1KG
|
|
|
|
|
|
| | PERFLUORODECANOIC ACID Basic information |
| Product Name: | PERFLUORODECANOIC ACID | | Synonyms: | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Nonadecafluorodecanoic acid;Ndfda;nonadecafluorodecanoic;n-Perfluorodecanoic acid;Nonadecafluorocapric acid, Perfluorocapric acid, Perfluorodecanoic acid;Nonadecafluorocapric acid, Nonadecafluorodecanoic acid, Perfluorocapric acid, Perfluorodecanoic acid;Nonadecafluorodecanoic acid,96%;nonadecafluoro-decanoicaci | | CAS: | 335-76-2 | | MF: | C10HF19O2 | | MW: | 514.08 | | EINECS: | 206-400-3 | | Product Categories: | Building Blocks;C10;Carbonyl Compounds;Carboxylic Acids;Chemical Synthesis;Fluorinated Building Blocks;F-Tagged;Organic Building Blocks;Organic Fluorinated Building Blocks;Synthetic Organic Chemistry;Fluorous Chemistry;Fluorous Compounds | | Mol File: | 335-76-2.mol |  |
| | PERFLUORODECANOIC ACID Chemical Properties |
| Melting point | 77-81 °C (lit.) | | Boiling point | 218 °C/740 mmHg (lit.) | | density | 1.7490 (estimate) | | vapor pressure | ~10 mm Hg ( 0 °C) | | Fp | 218°C | | storage temp. | 2-8°C | | solubility | methanol: soluble10%, clear to very slightly hazy, colorless to faintly yellow | | pka | 0.52±0.10(Predicted) | | form | A liquid | | color | White to Almost white | | BRN | 1810811 | | Henry's Law Constant | 2.5×10-2 mol/(m3Pa) at 25℃, Arp et al. (2006) | | Stability: | Stable. Incompatible with strong bases, oxidizing agents, reducing agents. | | InChI | 1S/C10HF19O2/c11-2(12,1(30)31)3(13,14)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)9(25,26)10(27,28)29/h(H,30,31) | | InChIKey | PCIUEQPBYFRTEM-UHFFFAOYSA-N | | SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 335-76-2(CAS DataBase Reference) | | EPA Substance Registry System | Perfluorodecanoic acid (335-76-2) |
| Hazard Codes | T,C | | Risk Statements | 25-36/37/38 | | Safety Statements | 26-45 | | RIDADR | UN 2811 6.1/PG 2 | | WGK Germany | 3 | | RTECS | HD9900000 | | Hazard Note | Corrosive | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29159000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Carc. 2 Lact. Repr. 1B | | Toxicity | LD50 orl-rat: 57 mg/kg TXAPA9 85,169,86 |
| | PERFLUORODECANOIC ACID Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | Perfluorodecanoic acid was used to evaluate the effect of nonadecafluorocapric acid on the levels of six thyroid function variables (thyroid stimulating hormone, free and total thyroxine, free and total triiodothyronine and thyroglobulin). | | Definition | ChEBI: A fluoroalkanoic acid that is perfluorinated decanoic acid. | | General Description | Liquid. | | Reactivity Profile | PERFLUORODECANOIC ACID is incompatible with strong oxidizing agents. | | Health Hazard | ACUTE/CHRONIC HAZARDS: Decomposition products of PERFLUORODECANOIC ACID include carbon monoxide, carbon dioxide, and hydrogen fluoride. It may be harmful by inhalation, ingestion, or skin absorption. | | Fire Hazard | Flash point data on PERFLUORODECANOIC ACID are not available. PERFLUORODECANOIC ACID is probably combustible. | | Safety Profile | Poison by ingestion and intraperitoneal routes. An experimental teratogen. Experimental reproductive effects. Mutation data reported. When heated to decomposition it emits toxic fumes of F-. |
| | PERFLUORODECANOIC ACID Preparation Products And Raw materials |
|