|
|
| | L-2-Aminooxy-3-phenylpropionic acid Basic information |
| Product Name: | L-2-Aminooxy-3-phenylpropionic acid | | Synonyms: | alpha-aminooxy-beta-phenylpropionic acid;3-(2-aminooxyphenyl)propanoic acid;(S)-2-aminooxy-3-phenylpropanoic acid;Benzenepropanoic acid, α-(aminooxy)-, (αS)-;(S)-2-aminooxy-3-phenylpropanoicaci;L-2-Aminooxy-3-phenylpropanoic acid;L-2-Aminooxy-3-phenylpropionic acid | | CAS: | 42990-62-5 | | MF: | C9H11NO3 | | MW: | 181.19 | | EINECS: | | | Product Categories: | | | Mol File: | 42990-62-5.mol |  |
| | L-2-Aminooxy-3-phenylpropionic acid Chemical Properties |
| Boiling point | 371.4±35.0 °C(Predicted) | | density | 1.260±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | pka | 2.82±0.10(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1/C9H11NO3/c10-13-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/s3 | | InChIKey | BRKLOAHUJZWUQQ-SBYBRXNCNA-N | | SMILES | C1(C=CC=CC=1)C[C@H](ON)C(=O)O |&1:7,r| |
| | L-2-Aminooxy-3-phenylpropionic acid Usage And Synthesis |
| Uses | L-2-Aminooxy-3-phenylpropanoic acid is a potent inhibitor of L-phenylalanine ammonia-lyase[1]. | | References | [1] NikolausAmrhein, et al. α-aminooxy-β-phenylpropionic acid — a potent inhibitor of L-phenylalanine ammonia-lyase in vitro and in vivo. Plant Science Letters Volume 8, Issue 4, April 1977, Pages 313-317. |
| | L-2-Aminooxy-3-phenylpropionic acid Preparation Products And Raw materials |
|