|
|
| | 4'-METHOXY-2-PHENYLACETOPHENONE Basic information |
| | 4'-METHOXY-2-PHENYLACETOPHENONE Chemical Properties |
| Melting point | 77-78 °C | | Boiling point | 380.0±17.0 °C(Predicted) | | density | 1.100±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Dichloromethane, Ethyl Acetate | | form | Solid | | color | White Crystalline | | InChI | InChI=1S/C15H14O2/c1-17-14-9-7-13(8-10-14)15(16)11-12-5-3-2-4-6-12/h2-10H,11H2,1H3 | | InChIKey | PLALKSRAHVYFOH-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(OC)C=C1)CC1=CC=CC=C1 | | CAS DataBase Reference | 1023-17-2(CAS DataBase Reference) |
| | 4'-METHOXY-2-PHENYLACETOPHENONE Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | An intermediate for the synthesis of many biologically active molecules including receptor ligands and enzyme inhibitors |
| | 4'-METHOXY-2-PHENYLACETOPHENONE Preparation Products And Raw materials |
|