- pentacene-6,13-dione
-
- $0.01 / 1KG
-
2020-01-10
- CAS:3029-32-1
- Min. Order: 1KG
- Purity: 98%; 99%
- Supply Ability: 500g;1kg； 25kg
|
| | 6,13-Pentacenequinone Basic information |
| Product Name: | 6,13-Pentacenequinone | | Synonyms: | 6,13-PENTACENEDIONE;6,13-PENTACENEQUINONE;6,13-PENTACENEQUINONE 99%;6,13-Dihydropentacene-6,13-dione;6,13-Pentacenequinone,99%;6,13-Pentacenequinone6,13-Pentacenedione;6,13-Pntacenequinone;pentacene－6,13-dione | | CAS: | 3029-32-1 | | MF: | C22H12O2 | | MW: | 308.33 | | EINECS: | | | Product Categories: | Electronic Chemicals | | Mol File: | 3029-32-1.mol |  |
| | 6,13-Pentacenequinone Chemical Properties |
| Melting point | 394 °C | | Boiling point | 388.73°C (rough estimate) | | density | 1.2343 (rough estimate) | | refractive index | 1.5344 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | Powder | | color | Yellow | | Water Solubility | insoluble | | Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C22H12O2/c23-21-17-9-13-5-1-2-6-14(13)10-18(17)22(24)20-12-16-8-4-3-7-15(16)11-19(20)21/h1-12H | | InChIKey | UFCVADNIXDUEFZ-UHFFFAOYSA-N | | SMILES | C1=CC2=CC3C(=O)C4=CC5=CC=CC=C5C=C4C(=O)C=3C=C2C=C1 | | NIST Chemistry Reference | 6,13-Pentacenedione(3029-32-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29146990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 6,13-Pentacenequinone Usage And Synthesis |
| Chemical Properties | yellow powder | | Uses | 6,13-Pentacenequinone has been used in:
- deposition of 6,13-pentacenequinone thin films on n-Si substrates by thermal evaporation
- as precursor to diarylpentacenes, potential organic field-effect transitors
| | General Description | Electronic structure of the lowest excited triplet state of 6,13-pentacenequinone has been studied by continuous-wave time-resolved electron paramagnetic resonance and pulsed electron nuclear double resonance. |
| | 6,13-Pentacenequinone Preparation Products And Raw materials |
|