|
|
| | 3-Trifluoromethylbenzylsulfonyl chloride Basic information |
| Product Name: | 3-Trifluoromethylbenzylsulfonyl chloride | | Synonyms: | [[3-(TRIFLUOROMETHYL)PHENYL]METHYL]SULFONYL CHLORIDE;[3-(TRIFLUOROMETHYL)PHENYL]METHANESULFONYL CHLORIDE;3-TRIFLUOROMETHYLBENZYLSULFONYL CHLORIDE;4-TRIFLUOROMETHYLBENZYLSULFONYL CHLORIDE;(4-TRIFLUOROMETHYL-PHENYL)-METHANESULFONYL CHLORIDE;([4-(TRIFLUOROMETHYL)PHENYL]METHYL)SULFONYLCHLORIDE;[3-(Trifluoromethyl)phenyl]methylsulphonyl chloride, 3-[(Chlorosulphonyl)methyl]benzotrifluoride;3-(Trifluoromethyl)benzylsulphonyl chloride | | CAS: | 127162-96-3 | | MF: | C8H6ClF3O2S | | MW: | 258.65 | | EINECS: | | | Product Categories: | | | Mol File: | 127162-96-3.mol |  |
| | 3-Trifluoromethylbenzylsulfonyl chloride Chemical Properties |
| Melting point | 173 °C | | Boiling point | 283.180±40.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.507±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | Fp | 125℃ | | form | solid | | InChI | InChI=1S/C8H6ClF3O2S/c9-15(13,14)5-6-2-1-3-7(4-6)8(10,11)12/h1-4H,5H2 | | InChIKey | WIGCBGFBBRJTLS-UHFFFAOYSA-N | | SMILES | C1(CS(Cl)(=O)=O)=CC=CC(C(F)(F)F)=C1 | | CAS DataBase Reference | 127162-96-3(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn,C | | Risk Statements | 34-22 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 3261 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2904990090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
| | 3-Trifluoromethylbenzylsulfonyl chloride Usage And Synthesis |
| | 3-Trifluoromethylbenzylsulfonyl chloride Preparation Products And Raw materials |
|