| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Trifluoromethylbenzylsulfonyl chloride Basic information |
| | 4-Trifluoromethylbenzylsulfonyl chloride Chemical Properties |
| Melting point | 103-105°C | | Boiling point | 293.5±40.0 °C(Predicted) | | density | 1.506±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | crystals | | Appearance | White to off-white Solid | | InChI | 1S/C8H6ClF3O2S/c9-15(13,14)5-6-1-3-7(4-2-6)8(10,11)12/h1-4H,5H2 | | InChIKey | KKBNUPMMAGEQAT-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1ccc(CS(Cl)(=O)=O)cc1 |
| Hazard Codes | C | | Risk Statements | 22-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN3261 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29049090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
| | 4-Trifluoromethylbenzylsulfonyl chloride Usage And Synthesis |
| Chemical Properties | White crystalline powder |
| | 4-Trifluoromethylbenzylsulfonyl chloride Preparation Products And Raw materials |
|