- 4,4'-AZOXYANISOLE
-
- $1.00
-
2020-01-13
- CAS:1562-94-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100KG
|
| | 4,4'-AZOXYANISOLE Basic information |
| | 4,4'-AZOXYANISOLE Chemical Properties |
| Melting point | 117-119 °C (lit.) | | Boiling point | 401.53°C (rough estimate) | | density | 1.14 | | refractive index | 1.6419 (estimate) | | storage temp. | -20°C | | form | powder to crystal | | color | Light yellow to Brown | | BRN | 752723 | | Dielectric constant | 2.3(50.0℃) | | InChI | 1S/C14H14N2O3/c1-18-13-7-3-11(4-8-13)15-16(17)12-5-9-14(19-2)10-6-12/h3-10H,1-2H3/b16-15- | | InChIKey | KAEZRSFWWCTVNP-NXVVXOECSA-N | | SMILES | COc1ccc(cc1)\N=[N+](/[O-])c2ccc(OC)cc2 | | CAS DataBase Reference | 1562-94-3(CAS DataBase Reference) | | EPA Substance Registry System | 4,4'-Azoxyanisole (1562-94-3) |
| Provider | Language |
|
ACROS
| English |
| | 4,4'-AZOXYANISOLE Usage And Synthesis |
| Chemical Properties | bright yellow crystalline powder | | General Description | Yellow monoclinic needles (in alcohol) or bright yellow crystals. | | Air & Water Reactions | Dust may form an explosive mixture in air. Insoluble in water. | | Reactivity Profile | 4,4'-AZOXYANISOLE is incompatible with strong oxidizing agents and strong reducing agents. | | Fire Hazard | Flash point data for 4,4'-AZOXYANISOLE are not available; however, 4,4'-AZOXYANISOLE is probably combustible. |
| | 4,4'-AZOXYANISOLE Preparation Products And Raw materials |
|