| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
inquiry@bocsci.com |
|
| | 8-(4-Chlorophenylthio)guanosine 3',5'-cyclic monophosphate sodium salt Basic information |
| Product Name: | 8-(4-Chlorophenylthio)guanosine 3',5'-cyclic monophosphate sodium salt | | Synonyms: | 8-(4-chlorophenylthio)guanosine*3’:5’-cyclicmono;8-(4-chlorophenylthio)guanosine-3’,5’-cyclicmonophosphate(8-pcpt-cgmp),sodiumsalt;8-(4-CHLOROPHENYLTHIO)GUANOSINE 3':5'-CYLIC MONOPHOSPHATE SODIUM SALT;8-PCPT-CGMP NA;8-PCPT-CGMP SODIUM SALT;8-PCPT-CGMP TEA;CGMP, 8-PCPT-, NA;8-(4-CHLOROPHENYLTHIO)GUANOSINE3':5'-CYC LIC MONOPH | | CAS: | 51239-26-0 | | MF: | C16H15ClN5O7PS.Na | | MW: | 510.8 | | EINECS: | | | Product Categories: | | | Mol File: | 51239-26-0.mol |  |
| | 8-(4-Chlorophenylthio)guanosine 3',5'-cyclic monophosphate sodium salt Chemical Properties |
| storage temp. | -20°C | | solubility | H2O: 25 mg/mL | | form | powder | | color | white | | Water Solubility | H2O: 25mg/mL | | InChIKey | REEQGIQRCDWDRA-ZBMQJGODSA-M | | SMILES | [Na+].NC1=Nc2c(nc(Sc3ccc(Cl)cc3)n2[C@@H]4O[C@@H]5COP([O-])(=O)O[C@H]5[C@H]4O)C(=O)N1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 8-(4-Chlorophenylthio)guanosine 3',5'-cyclic monophosphate sodium salt Usage And Synthesis |
| Uses | 8-(4-Chlorophenylthio)-guanosine 3′,5′-cyclic monophosphate sodium salt has been used to activate GMP-dependent protein kinase (PKG) in vascular smooth muscle cells (VSMCs). | | Definition | ChEBI: 8-(4-chlorophenylthio)-cGMP.Na is an organic sodium salt that is the monosodium salt of 8-(4-chlorophenylthio)-cGMP. It has a role as a protein kinase agonist. It contains an 8-(4-chlorophenylthio)-cGMP(1-). | | Biochem/physiol Actions | Membrane-permeable analog of cGMP that does not affect cGMP-regulated phosphodiesterase. A more potent cGMP analog than 8-Br-cGMP due to greater membrane permeability and a higher resistance to hydrolysis by phosphodiesterase. Used as a selective activator of cGMP dependent protein kinase (PKG). Found to be a very potent cyclic nucleotide-gated channel agonist. |
| | 8-(4-Chlorophenylthio)guanosine 3',5'-cyclic monophosphate sodium salt Preparation Products And Raw materials |
|