|
|
| | N-Phenylcarbamic acid methyl ester Basic information |
| Product Name: | N-Phenylcarbamic acid methyl ester | | Synonyms: | carbamicacid,phenyl-,methylester;Carbanilic acid, methyl ester;Methyl carbanilate;Methyl N-phenylurethane;Methyl phenylurethane;methylphenylcarbamate;METHYL N-PHENYLCARBAMATE;MethylN-Phenylcarbamate> | | CAS: | 2603-10-3 | | MF: | C8H9NO2 | | MW: | 151.16 | | EINECS: | 220-014-2 | | Product Categories: | | | Mol File: | 2603-10-3.mol |  |
| | N-Phenylcarbamic acid methyl ester Chemical Properties |
| Melting point | 47°C | | Boiling point | 126 °C / 10mmHg | | density | 1.2023 (rough estimate) | | refractive index | 1.5810 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | pka | 13.86±0.70(Predicted) | | color | White to Light yellow to Light red | | InChI | InChI=1S/C8H9NO2/c1-11-8(10)9-7-5-3-2-4-6-7/h2-6H,1H3,(H,9,10) | | InChIKey | IAGUPODHENSJEZ-UHFFFAOYSA-N | | SMILES | C(OC)(=O)NC1=CC=CC=C1 |
| | N-Phenylcarbamic acid methyl ester Usage And Synthesis |
| | N-Phenylcarbamic acid methyl ester Preparation Products And Raw materials |
|