|
|
| | 1,3-DIVINYL-1,3-DIPHENYL-1,3-DIMETHYLDISILOXANE Basic information |
| Product Name: | 1,3-DIVINYL-1,3-DIPHENYL-1,3-DIMETHYLDISILOXANE | | Synonyms: | 1,3-diethenyl-1,3-dimethyl-1,3-diphenyl-disiloxan;1,3-diethenyl-1,3-dimethyl-1,3-diphenyl-Disiloxane;1,3-dimethyl-1,3-diphenyl-1,3-divinyl-Disiloxane;Disiloxane,1,3-diethenyl-1,3-dimethyl-1,3-diphenyl-;1,3-Diethenyl-1,3-dimethyl-1,3-diphenylpropanedisiloxane;1,3-Dimethyl-1,3-diphenyl-1,3-divinylpropanedisiloxane;ethenyl-(ethenyl-methyl-phenyl-silyl)oxy-methyl-phenyl-silane;ethenyl-(ethenyl-methyl-phenylsilyl)oxy-methyl-phenylsilane | | CAS: | 2627-97-6 | | MF: | C18H22OSi2 | | MW: | 310.54 | | EINECS: | 220-101-5 | | Product Categories: | | | Mol File: | 2627-97-6.mol |  |
| | 1,3-DIVINYL-1,3-DIPHENYL-1,3-DIMETHYLDISILOXANE Chemical Properties |
| Melting point | <25°C | | Boiling point | 160°C 6mm | | density | 0,995 g/cm3 | | refractive index | 1.5310 | | Fp | >110°C | | form | clear liquid | | Specific Gravity | 0.995 | | color | Colorless to Almost colorless | | Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems | | InChI | InChI=1S/C18H22OSi2/c1-5-20(3,17-13-9-7-10-14-17)19-21(4,6-2)18-15-11-8-12-16-18/h5-16H,1-2H2,3-4H3 | | InChIKey | KPWVUBSQUODFPP-UHFFFAOYSA-N | | SMILES | [Si](C=C)(C)(C1=CC=CC=C1)O[Si](C=C)(C)C1=CC=CC=C1 | | EPA Substance Registry System | Disiloxane, 1,3-diethenyl-1,3-dimethyl-1,3-diphenyl- (2627-97-6) |
| | 1,3-DIVINYL-1,3-DIPHENYL-1,3-DIMETHYLDISILOXANE Usage And Synthesis |
| Toxics Screening Level | The ITSL for dimethyldiphenydivinylsiloxane has been changed from 0.04 μg/m3 to
0.1 μg/m3 based on an annual averaging time. |
| | 1,3-DIVINYL-1,3-DIPHENYL-1,3-DIMETHYLDISILOXANE Preparation Products And Raw materials |
|