| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- Methylene Chloride
-
- $1.00
-
2019-09-02
- CAS:480424-70-2
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1kg; 2kg;10kg; 100kg
|
| | 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate Basic information |
| Product Name: | 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate | | Synonyms: | 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenylacetate,min.97%;4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL ACETATE, MIN. 97%;4-ACETOXYPHENYLBORONIC ACID, PINACOL ESTER;2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate;4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate 95+%;4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate ,97%;2-[4-(tetraMethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate;4-Acetoxyphenylboronic acid pinacol ester
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate | | CAS: | 480424-70-2 | | MF: | C14H19BO4 | | MW: | 262.11 | | EINECS: | | | Product Categories: | organic or inorganic borate | | Mol File: | 480424-70-2.mol |  |
| | 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate Chemical Properties |
| Melting point | 67-71 °C (lit.) | | Boiling point | 351.9±25.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | color | white to yellow | | InChI | 1S/C14H19BO4/c1-10(16)17-12-8-6-11(7-9-12)15-18-13(2,3)14(4,5)19-15/h6-9H,1-5H3 | | InChIKey | KHBAJCWEQNVCSN-UHFFFAOYSA-N | | SMILES | CC(=O)Oc1ccc(cc1)B2OC(C)(C)C(C)(C)O2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | HS Code | 29189900 | | Storage Class | 11 - Combustible Solids |
| | 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate Usage And Synthesis |
| Chemical Properties | White crystalline powder |
| | 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate Preparation Products And Raw materials |
|