| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-(Trifluoromethyl)benzhydrazide Basic information |
| | 4-(Trifluoromethyl)benzhydrazide Chemical Properties |
| Melting point | 115-119 °C(lit.) | | density | 1.356±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 11.90±0.10(Predicted) | | color | Off-White | | BRN | 1968848 | | InChI | 1S/C8H7F3N2O/c9-8(10,11)6-3-1-5(2-4-6)7(14)13-12/h1-4H,12H2,(H,13,14) | | InChIKey | GKBDXTNCBPZMFX-UHFFFAOYSA-N | | SMILES | NNC(=O)c1ccc(cc1)C(F)(F)F | | CAS DataBase Reference | 339-59-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2928009090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-(Trifluoromethyl)benzhydrazide Usage And Synthesis |
| Uses | 4-(Trifluoromethyl)benzhydrazide is a reagent used in the synthesis of benzoyl hydrazone derivatives displaying fungicidal activity. | | General Description | 4-(Trifluoromethyl)benzhydrazide [4-(Trifluoromethyl)benzohydrazide] is an aroyl hydrazine. |
| | 4-(Trifluoromethyl)benzhydrazide Preparation Products And Raw materials |
|