|
|
| | 4-HYDROXYPHTHALIC ANHYDRIDE Basic information |
| Product Name: | 4-HYDROXYPHTHALIC ANHYDRIDE | | Synonyms: | 4-HYDROXYPHTHALIC ANHYDRIDE;5-hydroxy-2-benzofuran-1,3-dione;5-hydroxy-1,3-dihydro-2-benzofuran-1,3-dione;4-Hydroxy-phthalicanhydrid;1,3-Isobenzofurandione,5-hydroxy-;5-Hydroxy-1,3-isobenzofurandione, 98+%;Hydroxyisobenzofuran;5-hydroxyisobenzofuran-1,3-dione | | CAS: | 27550-59-0 | | MF: | C8H4O4 | | MW: | 164.12 | | EINECS: | | | Product Categories: | | | Mol File: | 27550-59-0.mol |  |
| | 4-HYDROXYPHTHALIC ANHYDRIDE Chemical Properties |
| Melting point | 171-173 °C(Solv: acetic acid (64-19-7)) | | Boiling point | 407.8±28.0 °C(Predicted) | | density | 1.624±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 6.52±0.20(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C8H4O4/c9-4-1-2-5-6(3-4)8(11)12-7(5)10/h1-3,9H | | InChIKey | PXHIYFMTRHEUHZ-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=C(O)C=C2)C(=O)O1 |
| | 4-HYDROXYPHTHALIC ANHYDRIDE Usage And Synthesis |
| Uses | 4-Hydroxyphthalic anhydride is a derivative of 3-hydroxyphthalic anhydride and can be used to modify proteins for in vitro biologics studies. | | Synthesis | The sublimation reaction was carried out at 220 °C and under vacuum conditions (~10 mbar) using 4-hydroxyphthalic acid (1 g, 5.49 mmol) as the raw material. Upon completion of the reaction, the resulting white solid 5-hydroxyisobenzofuran-1,3-dione (675 mg, 4.11 mmol, 74.9% yield, MS/ESI+ 164.9 [MH]+) was collected. The product is to be stored under vacuum and used directly in subsequent reaction steps. | | References | [1] Bioorganic and Medicinal Chemistry Letters, 2005, vol. 15, # 20, p. 4427 - 4431
[2] Journal of Medicinal Chemistry, 2011, vol. 54, # 1, p. 342 - 353
[3] Patent: CN104910113, 2017, B. Location in patent: Page/Page column 0041; 0044-0046
[4] European Journal of Medicinal Chemistry, 1987, vol. 22, p. 229 - 238
[5] Patent: US2013/102576, 2013, A1. Location in patent: Paragraph 0607 |
| | 4-HYDROXYPHTHALIC ANHYDRIDE Preparation Products And Raw materials |
|