1-Boc-4-(4-methoxycarbonylphenyl)piperazine manufacturers
|
| | 1-Boc-4-(4-methoxycarbonylphenyl)piperazine Basic information |
| | 1-Boc-4-(4-methoxycarbonylphenyl)piperazine Chemical Properties |
| Melting point | 166-170 °C (lit.) | | Boiling point | 451.731±40.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.153±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Store at room temperature | | form | solid | | pka | 2.429±0.10(predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C17H24N2O4/c1-17(2,3)23-16(21)19-11-9-18(10-12-19)14-7-5-13(6-8-14)15(20)22-4/h5-8H,9-12H2,1-4H3 | | InChIKey | SMDBCJAJWDCJOP-UHFFFAOYSA-N | | SMILES | COC(=O)c1ccc(cc1)N2CCN(CC2)C(=O)OC(C)(C)C |
| Hazard Codes | T | | Risk Statements | 25-52/53 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 2 | | Hazard Note | Harmful | | HS Code | 2933599590 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Oral |
| | 1-Boc-4-(4-methoxycarbonylphenyl)piperazine Usage And Synthesis |
| | 1-Boc-4-(4-methoxycarbonylphenyl)piperazine Preparation Products And Raw materials |
|