|
|
| | Chlorophenyltriethoxysilane Basic information |
| Product Name: | Chlorophenyltriethoxysilane | | Synonyms: | p-chlorophenyltriethoxysilane7%;p-chlorophenyltrimethoxysilane;Silane, (4-chlorophenyl)triethoxy-;(4-chlorophenyl)triethoxy-silan;(4-chlorophenyl)triethoxy-Silane;Chlorophenyltriethoxysilane(mixed m.p isomers);1-CHLORO-4-TRIETHOXYSILYLBENZENE;P-CHLOROPHENYLTRIETHOXYSILANE | | CAS: | 21700-74-3 | | MF: | C12H19ClO3Si | | MW: | 274.82 | | EINECS: | 244-533-9 | | Product Categories: | | | Mol File: | 21700-74-3.mol |  |
| | Chlorophenyltriethoxysilane Chemical Properties |
| Melting point | <0°C | | Boiling point | 82-84 °C0.07 mm Hg(lit.) | | density | 1.069 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.474(lit.) | | Fp | >230 °F | | Specific Gravity | 1.08 | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | 1S/C12H19ClO3Si/c1-4-14-17(15-5-2,16-6-3)12-9-7-11(13)8-10-12/h7-10H,4-6H2,1-3H3 | | InChIKey | AFILDYMJSTXBAR-UHFFFAOYSA-N | | SMILES | CCO[Si](OCC)(OCC)c1ccc(Cl)cc1 | | EPA Substance Registry System | Silane, (4-chlorophenyl)triethoxy- (21700-74-3) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids |
| | Chlorophenyltriethoxysilane Usage And Synthesis |
| Uses | (4-Chlorophenyl)triethoxysilane can be used:
- To facilitate the connection between dipolar mixed monolayers andzinc oxide in photovoltaic devices.
- As a substrate in the Ni-catalyzed decarboxylative coupling with alkynyl carboxylic acids to yield substituted diarylalkynes.
- As a substrate in the Hiyama cross-coupling reactions with 3-iodoazetidines to yield substituted 3-arylazetidines.
- As an intermediate in the synthesis of tripod-shaped oligo(p-phenylene)s, which are used in the surface immobilization of gold and CdS quantum dots for sensor applications.
|
| | Chlorophenyltriethoxysilane Preparation Products And Raw materials |
|