- Fura-2 AM
-
- $328.00
-
2026-07-17
- CAS:108964-32-5
- Purity: 98.05%
- Supply Ability: 10g
|
| | Fura 2-AM Basic information |
| Product Name: | Fura 2-AM | | Synonyms: | FURA 2/AM;FURA 2/AM in Solution - CAS 108964-32-5 - Calbiochem;FURA-2/AM, FOR FLUORESCENCE;FURA 2-AM SPECIAL PACKAGING;FURA 2/AM in Solution;fura 2-am yellow powder;Fura?-AM;FURA2/AM *1SET = 10x100UG** | | CAS: | 108964-32-5 | | MF: | C44H47N3O24 | | MW: | 1001.85 | | EINECS: | | | Product Categories: | Benzofuran | | Mol File: | 108964-32-5.mol |  |
| | Fura 2-AM Chemical Properties |
| Melting point | >250℃ | | Boiling point | 975.9±75.0 °C(Predicted) | | density | 1.400±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | DMSO: soluble | | form | Powder | | pka | 1.89±0.50(Predicted) | | color | Yellow | | Appearance | Solid Powder | | Sensitive | Light Sensitive | | λmax | 370nm | | BRN | 8183748 | | Major Application | diagnostic assay manufacturing
hematology
histology | | Biological Applications | Calcium indicator; monitoring membrane potential; treating ischemia | | InChIKey | VPSRLGDRGCKUTK-UHFFFAOYSA-N | | SMILES | O1C(C(OCOC(C)=O)=O)=CN=C1C1=CC2=CC(OCCOC3=CC(C)=CC=C3N(CC(OCOC(C)=O)=O)CC(OCOC(C)=O)=O)=C(N(CC(OCOC(C)=O)=O)CC(OCOC(C)=O)=O)C=C2O1 | | CAS DataBase Reference | 108964-32-5(CAS DataBase Reference) |
| WGK Germany | 3 | | F | 8-10 | | Storage Class | 11 - Combustible Solids |
| | Fura 2-AM Usage And Synthesis |
| Description | Fura-2 AM is a cell-permeable fluorescent probe for detecting Ca2+ concentration. | | Chemical Properties | yellow powder | | Uses | High affinity, excitation-ratiometric fluorescent indicator for quantifying intracellular Ca2+ concentration | | Uses | A calcium indicator; derivative of Fura-2 used to load the chelator into cells | | Uses | Membrane-permeable analog of Fura 2 with high selectivity for Ca2+ binding. Fura 2-AM can be delivered into cells by microinjection or using Influx pinocytic cell-loading reagent. After crossing the membrane, the product is quickly metabolized by cytoplas | | Biological Activity | Fluorescent Ca 2+ indicator. Selective for Ca 2+ over other divalent cations Mg 2+ , Zn 2+ , Fe 2+ and Mn 2+ . Used to determine intracellular Ca 2+ concentration. | | storage | -20°C | | Excitation / Emission Maximum | 340-380 nm/510 nm |
| | Fura 2-AM Preparation Products And Raw materials |
|