|
|
| | 5-(1,3,2-Dioxaborinan-2-yl)-3-methylthiophene-2-carboxaldehyde Basic information |
| Product Name: | 5-(1,3,2-Dioxaborinan-2-yl)-3-methylthiophene-2-carboxaldehyde | | Synonyms: | 5-FORMYL-4-METHYLTHIOPHENE-2-BORONIC ACID 1,3-PROPANEDIOL CYCLIC ESTER;5-FORMYL-4-METHYLTHIOPHENE-2-BORONIC ACID 1,3-PROPANEDIOL ESTER;5-FORMYL-4-METHYLTHIOPHENE-2-BORONIC ACID 1,3-PROPANEDIOL ES;5-(1,3,2-Dioxaborinan-2-yl)-3-methylthiophene-2-carboxaldehyde~2-(2-Formyl-3-methylthien-5-yl)-1,3,2-dioxaborinane;2-(2-formyl-3-methylthien-5-yl)-1,3,2-dioxaborinane;5-(1,3,2-dioxaborinan-2-yl)-3-methylthiophene-2-carboxaldehyde;5-(1,3,2-Dioxaborinan-2-yl)-3-methylthiophene-2-carbaldehyde;5-(1,3,2-dioxaborinan-2-yl)-3-methyl-2-thiophenecarboxaldehyde | | CAS: | 374537-98-1 | | MF: | C9H11BO3S | | MW: | 210.06 | | EINECS: | | | Product Categories: | Boronic acids | | Mol File: | 374537-98-1.mol |  |
| | 5-(1,3,2-Dioxaborinan-2-yl)-3-methylthiophene-2-carboxaldehyde Chemical Properties |
| Melting point | 66°C | | Boiling point | 397.6±42.0 °C(Predicted) | | density | 1.20±0.1 g/cm3(Predicted) | | form | solid | | Sensitive | Air Sensitive | | InChI | 1S/C9H11BO3S/c1-7-5-9(14-8(7)6-11)10-12-3-2-4-13-10/h5-6H,2-4H2,1H3 | | InChIKey | HWKMZYCWSDPJQH-UHFFFAOYSA-N | | SMILES | B2(OCCCO2)c1[s]c(c(c1)C)C=O | | CAS DataBase Reference | 374537-98-1(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | WGK 3 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | 5-(1,3,2-Dioxaborinan-2-yl)-3-methylthiophene-2-carboxaldehyde Usage And Synthesis |
| | 5-(1,3,2-Dioxaborinan-2-yl)-3-methylthiophene-2-carboxaldehyde Preparation Products And Raw materials |
|