|
|
| | 5-Formyl-2-thiopheneboronic acid Basic information |
| | 5-Formyl-2-thiopheneboronic acid Chemical Properties |
| Melting point | 132-135 °C (lit.) | | Boiling point | 395.1±52.0 °C(Predicted) | | density | 1.41±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | solubility | soluble in Methanol | | pka | 7.23±0.53(Predicted) | | form | Powder or Cyrstals | | color | White | | Sensitive | Air Sensitive | | InChI | InChI=1S/C5H5BO3S/c7-3-4-1-2-5(10-4)6(8)9/h1-3,8-9H | | InChIKey | DEQOVKFWRPOPQP-UHFFFAOYSA-N | | SMILES | B(C1SC(C=O)=CC=1)(O)O | | CAS DataBase Reference | 4347-33-5(CAS DataBase Reference) |
| | 5-Formyl-2-thiopheneboronic acid Usage And Synthesis |
| Chemical Properties | White to orange powder | | Uses | suzuki reaction |
| | 5-Formyl-2-thiopheneboronic acid Preparation Products And Raw materials |
|