Boc-D-3,5-difluorophe manufacturers
- Boc-D-3,5-Difluorophe
-
- $2.20
-
2026-08-25
- CAS:205445-53-0
- Min. Order: 1kg
- Purity: 99%min
- Supply Ability: 100kg
|
| | Boc-D-3,5-difluorophe Basic information |
| Product Name: | Boc-D-3,5-difluorophe | | Synonyms: | Boc-D-3,5-Difluoro-phe-OH;N-Boc-D-Phe(3,5-F2)-OH;REF DUPL: N-Boc-D-Phe(3,5-F2)-OH;N-BOC-3,5-DIFLUORO-D-PHENYLALANINE;￡¨R￡-N-Boc-3,5-Difluorophenylalanine;Boc-D-Phe(3,5-F2)-OH Boc-3,5-Difluoro-D-Phenylalanine;BOC-3,5-DIFLUORO-D-PHENYLALANINE;BOC-D-PHE(3,5-DIF)-OH | | CAS: | 205445-53-0 | | MF: | C14H17F2NO4 | | MW: | 301.29 | | EINECS: | | | Product Categories: | Peptide;Phenylalanine analogs and other aromatic alpha amino acids;Amino Acids | | Mol File: | 205445-53-0.mol |  |
| | Boc-D-3,5-difluorophe Chemical Properties |
| Boiling point | 417.6±45.0 °C(Predicted) | | density | 1.270±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.73±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C14H17F2NO4/c1-14(2,3)21-13(20)17-11(12(18)19)6-8-4-9(15)7-10(16)5-8/h4-5,7,11H,6H2,1-3H3,(H,17,20)(H,18,19)/t11-/m1/s1 | | InChIKey | CZBNUDVCRKSYDG-LLVKDONJSA-N | | SMILES | C(O)(=O)[C@@H](CC1=CC(F)=CC(F)=C1)NC(OC(C)(C)C)=O |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2924297099 |
| | Boc-D-3,5-difluorophe Usage And Synthesis |
| | Boc-D-3,5-difluorophe Preparation Products And Raw materials |
|