| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | DL-3,5-Difluorophenylalanine Basic information |
| | DL-3,5-Difluorophenylalanine Chemical Properties |
| Melting point | 269.5-273.5 °C(lit.) | | Boiling point | 295.1±40.0 °C(Predicted) | | density | 1.379±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | Solid | | pka | 2.13±0.20(Predicted) | | color | White to off-white | | Major Application | peptide synthesis | | InChI | 1S/C9H9F2NO2/c10-6-1-5(2-7(11)4-6)3-8(12)9(13)14/h1-2,4,8H,3,12H2,(H,13,14) | | InChIKey | QFGMPXZFCIHYIR-UHFFFAOYSA-N | | SMILES | NC(Cc1cc(F)cc(F)c1)C(O)=O | | CAS DataBase Reference | 32133-37-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids |
| | DL-3,5-Difluorophenylalanine Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | DL-3,5-Difluorophenylalanine Preparation Products And Raw materials |
|