BOC-L-3,4-Difluorophe manufacturers
|
| | BOC-L-3,4-Difluorophe Basic information |
| | BOC-L-3,4-Difluorophe Chemical Properties |
| Melting point | 95-105°C | | Boiling point | 430.4±45.0 °C(Predicted) | | density | 1.270±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | slightly sol. in Methanol | | form | powder to crystal | | pka | 3.79±0.10(Predicted) | | color | White to Light yellow | | Optical Rotation | 5.3° (C=0.01 g/ml, MEOH) | | BRN | 8566144 | | Major Application | peptide synthesis | | InChI | 1S/C14H17F2NO4/c1-14(2,3)21-13(20)17-11(12(18)19)7-8-4-5-9(15)10(16)6-8/h4-6,11H,7H2,1-3H3,(H,17,20)(H,18,19)/t11-/m0/s1 | | InChIKey | CYAOPVHXASZUDE-NSHDSACASA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(F)c(F)c1)C(O)=O | | CAS DataBase Reference | 198474-90-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids |
| | BOC-L-3,4-Difluorophe Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-L-3,4-Difluorophe Preparation Products And Raw materials |
|