- L-Cyclopentylglycine
-
- $1.00
-
2020-01-03
- CAS:2521-84-8
- Min. Order: 1KG
- Purity: 95-99%
- Supply Ability: 1ton
|
| | L-Cyclopentylglycine Basic information |
| | L-Cyclopentylglycine Chemical Properties |
| Boiling point | 276.6±23.0 °C(Predicted) | | density | 1.167±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | Solid | | pka | 2.49±0.10(Predicted) | | color | White to off-white | | Optical Rotation | Consistent with structure | | InChI | InChI=1/C7H13NO2/c8-6(7(9)10)5-3-1-2-4-5/h5-6H,1-4,8H2,(H,9,10)/t6-/s3 | | InChIKey | XBPKRVHTESHFAA-ISZMHOAENA-N | | SMILES | [C@@H](C1CCCC1)(N)C(=O)O |&1:0,r| | | CAS DataBase Reference | 2521-84-8(CAS DataBase Reference) |
| | L-Cyclopentylglycine Usage And Synthesis |
| Uses | L-Cyclopentylglycine is used in the preparation and resolution of cyclopentaneglycine. | | Uses | 2-Cyclopentyl-L-glycine is used in the preparation and resolution of cyclopentaneglycine. |
| | L-Cyclopentylglycine Preparation Products And Raw materials |
|