|
|
| | Hexaphenylditin(IV) Basic information |
| Product Name: | Hexaphenylditin(IV) | | Synonyms: | 1,1,1,2,2,2-Hexaphenyldistannane;Distannane, hexaphenyl-;HEXAPHENYLDISTANNANE;Hexaphenylditin,99+%;hexaphenylditin(iv);Hexaphenylditin, 97+%;bis(triphenyltin);Distannane, 1,1,1,2,2,2-hexaphenyl- | | CAS: | 1064-10-4 | | MF: | C36H30Sn2 | | MW: | 700.04 | | EINECS: | 213-902-6 | | Product Categories: | organotin compound;OrganoditinsVapor Deposition Precursors;Organometallic Reagents;Organotin;Precursors by Metal;Tin | | Mol File: | 1064-10-4.mol |  |
| | Hexaphenylditin(IV) Chemical Properties |
| Melting point | 233-237 °C(lit.) | | Boiling point | 280°C | | Fp | 280°C | | form | Powder | | color | white | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | Exposure limits | ACGIH: TWA 0.1 mg/m3; STEL 0.2 mg/m3 (Skin)
NIOSH: IDLH 25 mg/m3; TWA 0.1 mg/m3 | | InChI | 1S/6C6H5.2Sn/c6*1-2-4-6-5-3-1;;/h6*1-5H;; | | InChIKey | UAPQJVJCJITJET-UHFFFAOYSA-N | | SMILES | c1ccc(cc1)[Sn](c2ccccc2)(c3ccccc3)[Sn](c4ccccc4)(c5ccccc5)c6ccccc6 | | EPA Substance Registry System | Distannane, hexaphenyl- (1064-10-4) |
| Hazard Codes | T,N | | Risk Statements | 23/24/25-50/53 | | Safety Statements | 26-27-28-45-60-61 | | RIDADR | UN 3146 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Aquatic Acute 1
Aquatic Chronic 1 |
| | Hexaphenylditin(IV) Usage And Synthesis |
| reaction suitability | core: tin |
| | Hexaphenylditin(IV) Preparation Products And Raw materials |
|