- Diethyl Phenylmalonate
-
- $10.70 / 1KG
-
2025-05-26
- CAS:83-13-6
- Min. Order: 10KG
- Purity: 99.5%
- Supply Ability: 10000kg
- Diethyl phenylmalonate
-
- $2380.00 / 200KG
-
2021-11-02
- CAS:83-13-6
- Min. Order: 200KG
- Purity: 99%
- Supply Ability: 2000T
|
| | Diethyl phenylmalonate Basic information |
| | Diethyl phenylmalonate Chemical Properties |
| Melting point | 16 °C (lit.) | | Boiling point | 170-172 °C/14 mmHg (lit.) | | density | 1.095 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.491(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | Liquid After Melting | | pka | 11.84±0.46(Predicted) | | color | Clear colorless to yellow | | Water Solubility | immiscible | | BRN | 614465 | | InChI | 1S/C13H16O4/c1-3-16-12(14)11(13(15)17-4-2)10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3 | | InChIKey | FGYDHYCFHBSNPE-UHFFFAOYSA-N | | SMILES | CCOC(=O)C(C(=O)OCC)c1ccccc1 | | LogP | 2.71 at 20℃ | | CAS DataBase Reference | 83-13-6(CAS DataBase Reference) | | NIST Chemistry Reference | Propanedioic acid, phenyl-, diethyl ester(83-13-6) | | EPA Substance Registry System | Propanedioic acid, phenyl-, diethyl ester (83-13-6) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29173980 | | Storage Class | 10 - Combustible liquids |
| | Diethyl phenylmalonate Usage And Synthesis |
| Chemical Properties | clear colourless to yellowish liquid after melting | | Uses | Diethyl phenylmalonate was used in the synthesis of felbamate-d4 (2-phenyl-1,3-propanediol-l,l,3,3-d4 dicarbamate) using lithium aluminum deuteride. | | General Description | Diethyl phenylmalonate was partially hydrolysed to the corresponding chiral monoester by various immobilized preparations of lipase from Thermomyces lanuginosa. |
| | Diethyl phenylmalonate Preparation Products And Raw materials |
|