| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1-(P-HYDROXYPHENYL)ETHYLAMINE Basic information |
| Product Name: | 1-(P-HYDROXYPHENYL)ETHYLAMINE | | Synonyms: | 4-(1-aminoethyl)-pheno;1-(P-HYDROXYPHENYL)ETHYLAMINE;TIMTEC-BB SBB008453;4-(1-AMINOETHYL)PHENOL ---OFF WHITE POWDER, PURITY 98%---;4-(1-aminoethyl)phenol(SALTDATA: HCl);1-(4-Hydroxyphenyl)ethylamine;Phenol, 4-(1-aminoethyl)-;(^+)-4-(1-Aminoethyl)phenol, 97% | | CAS: | 134855-87-1 | | MF: | C8H11NO | | MW: | 137.18 | | EINECS: | | | Product Categories: | | | Mol File: | 134855-87-1.mol |  |
| | 1-(P-HYDROXYPHENYL)ETHYLAMINE Chemical Properties |
| Boiling point | 252℃ | | density | 1.096 | | RTECS | SJ5950150 | | Fp | 106℃ | | pka | 10.20±0.26(Predicted) | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C8H11NO/c1-6(9)7-2-4-8(10)5-3-7/h2-6,10H,9H2,1H3 | | InChIKey | CDQPLIAKRDYOCB-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(C(N)C)C=C1 | | EPA Substance Registry System | Phenol, 4-(1-aminoethyl)- (134855-87-1) |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 |
| | 1-(P-HYDROXYPHENYL)ETHYLAMINE Usage And Synthesis |
| Uses | It is employed as a intermediate for pharmaceutical. | | Definition | ChEBI: 1-(p-Hydroxyphenyl)ethylamine is a member of phenols. |
| | 1-(P-HYDROXYPHENYL)ETHYLAMINE Preparation Products And Raw materials |
|