| Company Name: |
Huzhou ZhanShu Biotechnology Co.,Ltd Gold
|
| Tel: |
0572-8889530 18167260939 |
| Email: |
zsubio@163.com |
| Products Intro: |
Product Name:rabdosin C
CAS:82460-75-1
Purity:98 Package:20mg/RMB 1100
|
| Company Name: |
Wuhan ChemFaces Biochemical Co., Ltd.
|
| Tel: |
18607101326 15172504745 |
| Email: |
aileen@chemfaces.com |
| Products Intro: |
Product Name:Rabdophyllin G
CAS:82460-75-1
Purity:>=98% Package:5mg ,10mg ,20mg ,50mg ,100mg; 200mg; 500mg,可根据客户需求定制 Remarks:1908/5mg
|
|
| | RABDOPHYLLIN G Basic information |
| Product Name: | RABDOPHYLLIN G | | Synonyms: | 10-deepoxy-13-deoxy-5-hydroxy-8-(acetyloxy)-(5-alpha)-enmei;RABDOPHYLLIN G;isodonoiol;rabdosinc;RABDOPHYLLIN G USP/EP/BP;Enmein, 8-(acetyloxy)-8,10-deepoxy-13-deoxy-5-hydroxy-, (5α)-;Rabdosin C,Isodonoiol | | CAS: | 82460-75-1 | | MF: | C22H30O7 | | MW: | 406.47 | | EINECS: | | | Product Categories: | Miscellaneous Natural Products | | Mol File: | 82460-75-1.mol |  |
| | RABDOPHYLLIN G Chemical Properties |
| Boiling point | 600.8±55.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | pka | 13.84±0.70(Predicted) | | InChIKey | OCELUFZNLBUKGF-OJHTZNQBNA-N | | SMILES | [C@]12(COC(=O)C)[C@H](CO)C(CC[C@]1([H])OC(=O)[C@]13C(=O)C(=C)[C@]([H])(C[C@H](O)[C@@]21[H])C3)(C)C |&1:0,6,12,17,22,25,27,r| |
| | RABDOPHYLLIN G Usage And Synthesis |
| Description | Rabdosin C is a antineoplastic agent. It is isolated from leaves of Rabdosia japonic. | | Uses | Rabdosin C (Isodonoiol) is an ent-kaurane diterpenoidthat can be found in rubescens var. lushanensis. Rabdosin C shows cytotoxicity[1]. | | References | [1] Han QB,et al. Ent-kaurane diterpenoids from Isodon rubescens var. lushanensis. Chem Pharm Bull (Tokyo). 2003 Jul;51(7):790-3. DOI:10.1248/cpb.51.790 |
| | RABDOPHYLLIN G Preparation Products And Raw materials |
|