| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | 6-MPH4 DIHYDROCHLORIDE Basic information |
| Product Name: | 6-MPH4 DIHYDROCHLORIDE | | Synonyms: | 6-MPH4 DIHYDROCHLORIDE;DL-6-METHYL-5,6,7,8-TETRAHYDROPTERINE DIHYDROCHLORIDE;DL-2-AMINO-4-HYDROXY-6-METHYL 5,6,7,8-TETRAHYDROPTERIDINE DIHYDROCHLORIDE;(+/-)-6-methyl-5,6,7,8-tetrahydropte-rine dihydrochl.;DL-6-Methyl-5,6,7,8-tetrahydropterine, HCl;DL-6-METHYL-5,6,7,8-TETRAHYDROPTERINE*DI HYDROCHLORI;6-mph4;6-MPH4, DL-2-Amino-4-hydroxy-6-methyl-5,6,7,8-tetrahydropteridine dihydrochloride | | CAS: | 69113-63-9 | | MF: | C7H12ClN5O | | MW: | 217.66 | | EINECS: | | | Product Categories: | | | Mol File: | 69113-63-9.mol |  |
| | 6-MPH4 DIHYDROCHLORIDE Chemical Properties |
| storage temp. | -20°C | | form | Solid | | color | White to off-white | | BRN | 5648114 | | InChI | 1S/C7H11N5O.2ClH/c1-3-2-9-5-4(10-3)6(13)12-7(8)11-5;;/h3,10H,2H2,1H3,(H4,8,9,11,12,13);2*1H | | InChIKey | MKQLORLCFAZASZ-UHFFFAOYSA-N | | SMILES | Cl.Cl.CC1CNc2nc(N)nc(O)c2N1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 6-MPH4 DIHYDROCHLORIDE Usage And Synthesis |
| Uses | 6-MPH4 is used to study mechanisms of nitric oxide (NO) synthase and free radical induced L-DOPA release from striatal tissue. | | Biochem/physiol Actions | Synthetic cofactor for tyrosine hydrolase; also cofactor for phenylalanine and tryptophan hydroxylases; less activity than the natural cofactor, BH4 |
| | 6-MPH4 DIHYDROCHLORIDE Preparation Products And Raw materials |
|