| Company Name: |
ChemShuttle, Inc. |
| Tel: |
0510-83588313-811 18800520310 |
| Email: |
sales@chemshuttle.com |
| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
ML198 manufacturers
- ML198
-
- $88.00
-
2026-08-04
- CAS:1380716-06-2
- Purity: 98.54%
- Supply Ability: 10g
|
| Product Name: | ML198 | | Synonyms: | ML198;inhibit,ML198,ML-198,ML 198,GCase modulator,Inhibitor,Non-inhibitory chaperone,Gaucher disease,Glucosidase,Glucocerebrosidase;Pyrazolo[1,5-a]pyrimidine-3-carboxamide, N-(4-ethynylphenyl)-5,7-dimethyl-;ML198, 10 mM in DMSO;ML198 ，S3470 | | CAS: | 1380716-06-2 | | MF: | C17H14N4O | | MW: | 290.32 | | EINECS: | | | Product Categories: | | | Mol File: | 1380716-06-2.mol |  |
| | ML198 Chemical Properties |
| density | 1.20±0.1 g/cm3(Predicted) | | solubility | DMSO : 5 mg/mL (17.22 mM; ultrasonic and warming and adjust pH to 2 with HCl and heat to 60°C) | | pka | 11.49±0.70(Predicted) | | form | Solid | | color | Light yellow to yellow | | InChI | InChI=1S/C17H14N4O/c1-4-13-5-7-14(8-6-13)20-17(22)15-10-18-21-12(3)9-11(2)19-16(15)21/h1,5-10H,2-3H3,(H,20,22) | | InChIKey | HVZPJBKUFRREQC-UHFFFAOYSA-N | | SMILES | C12=C(C(NC3=CC=C(C#C)C=C3)=O)C=NN1C(C)=CC(C)=N2 |
| | ML198 Usage And Synthesis |
| Uses | N-(4-Ethynylphenyl)-5,7-dimethyl-pyrazolo[1,5-a]pyrimidine-3-carboxamide is derived from 5,7-Dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylic Acid (D478938), which is used as a reactant in the synthetic preparation of noninhibitory small molecule chaperones of glucocerebrosidase. |
| | ML198 Preparation Products And Raw materials |
|