| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Perfluorooctadecanoic acid Basic information |
| Product Name: | Perfluorooctadecanoic acid | | Synonyms: | pentatriacontafluoro-octadecanoicaci;PERFLUOROOCTADECANOIC ACID;PERFLUOROSTEARIC ACID;PENTATRIACONTAFLUOROOCTADECANOIC ACID;Perfluorooctadecanoic;Perfluorooctadecanoic acid 97%;Perfluorooctadecanoicacid97%;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,18-Pentatriacontafluorooctadecanoic acid | | CAS: | 16517-11-6 | | MF: | C18HF35O2 | | MW: | 914.14 | | EINECS: | 240-582-5 | | Product Categories: | | | Mol File: | 16517-11-6.mol |  |
| | Perfluorooctadecanoic acid Chemical Properties |
| Melting point | 162-164°C | | Boiling point | 235°C 100mm | | density | 1.786±0.06 g/cm3(Predicted) | | Fp | 235°C/100mm | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Very Slightly, Heated) | | pka | 0.52±0.10(Predicted) | | form | Solid | | color | White to Off-White | | Water Solubility | Insoluble in water. | | Major Application | environmental | | InChIKey | ZTSDOGSKTICNPQ-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)O | | CAS DataBase Reference | 16517-11-6(CAS DataBase Reference) | | EPA Substance Registry System | Octadecanoic acid, pentatriacontafluoro- (16517-11-6) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 3261 | | WGK Germany | WGK 3 | | Hazard Note | Corrosive | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 2915907098 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Carc. 2
Eye Dam. 1
Lact.
Repr. 1B
STOT RE 1 |
| Provider | Language |
|
ALFA
| English |
| | Perfluorooctadecanoic acid Usage And Synthesis |
| Uses | Perfluorooctadecanoic acid is a contaminant found in source water and treated drinking water from 25 drinking water treatment plants. It can also be found in discarded carpet and clothing in landfill leachate under biological active and abiotic conditions. |
| | Perfluorooctadecanoic acid Preparation Products And Raw materials |
|