| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- 4-Heptylamine
-
-
2026-09-09
- CAS:16751-59-0
- Min. Order: 100gm
- Purity: 99%min
- Supply Ability: 100kgs
|
| | 4-Heptylamine Basic information |
| Product Name: | 4-Heptylamine | | Synonyms: | 1-PROPYLBUTYLAMINE;1-Propylbutanamine;1-propyl-butylamin;4-Heptanamine;Butylamine, 1-propyl-;heptan-4-amine hydrochloride;heptan-4-ylazanium chloride;4-Aminoheptane 97% | | CAS: | 16751-59-0 | | MF: | C7H17N | | MW: | 115.22 | | EINECS: | 240-814-5 | | Product Categories: | Aliphatics;Amines | | Mol File: | 16751-59-0.mol |  |
| | 4-Heptylamine Chemical Properties |
| Melting point | -19°C (estimate) | | Boiling point | 140°C | | density | 0,77 g/cm3 | | refractive index | 1.4170 to 1.4190 | | pka | 11.04±0.35(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 0.77 | | InChI | InChI=1S/C7H17N/c1-3-5-7(8)6-4-2/h7H,3-6,8H2,1-2H3 | | InChIKey | CLJMMQGDJNYDER-UHFFFAOYSA-N | | SMILES | CCCC(N)CCC | | CAS DataBase Reference | 16751-59-0(CAS DataBase Reference) | | EPA Substance Registry System | 4-Heptanamine (16751-59-0) |
| Hazard Codes | Xn | | Risk Statements | 10-34-43-22 | | Safety Statements | 16-26-37/39-53 | | RIDADR | 2733 | | WGK Germany | 3 | | RTECS | EO6025000 | | TSCA | TSCA listed | | HazardClass | 3/8 | | PackingGroup | III | | HS Code | 2921199990 |
| | 4-Heptylamine Usage And Synthesis |
| Uses | 4-Aminoheptane
is used in organic syntheses. |
| | 4-Heptylamine Preparation Products And Raw materials |
|