| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | (+/-)-exo-6-Hydroxytropinone Basic information |
| | (+/-)-exo-6-Hydroxytropinone Chemical Properties |
| Melting point | 120-121 °C(lit.) | | Boiling point | 279°C (rough estimate) | | density | 1.1174 (rough estimate) | | refractive index | 1.4890 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly, Sonicated), DMSO (Slightly, Sonicated), Methanol (Slightly) | | form | Solid | | pka | 14.36±0.20(Predicted) | | color | Light Orange to Brown | | InChI | InChI=1/C8H13NO2/c1-9-5-2-6(10)4-7(9)8(11)3-5/h5,7-8,11H,2-4H2,1H3/t5-,7+,8-/s3 | | InChIKey | UOHSTKWPZWFYTF-PIIPYSPBNA-N | | SMILES | [C@@]12([H])N(C)[C@@]([H])([C@@H](O)C1)CC(=O)C2 |&1:0,4,6,r| | | LogP | -1.000 (est) | | CAS DataBase Reference | 5932-53-6(CAS DataBase Reference) |
| Risk Statements | 23/25 | | Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29399990 |
| | (+/-)-exo-6-Hydroxytropinone Usage And Synthesis |
| Chemical Properties | off-white to beige crystals or crystalline powder | | Uses | (+/-)-Exo-6-hydroxytropinone is a useful reagent for the preparation of racemic scopolamine (tropane alkaloid). |
| | (+/-)-exo-6-Hydroxytropinone Preparation Products And Raw materials |
|