| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-Iodo-3-(pentafluorosulfanyl)benzene Basic information |
| | 1-Iodo-3-(pentafluorosulfanyl)benzene Chemical Properties |
| Boiling point | 57 °C / 0.5mmHg | | density | 2.06 | | refractive index | 1.5170 to 1.5210 | | storage temp. | Refrigerator | | form | clear liquid | | color | Colorless to Red to Green | | InChI | InChI=1S/C6H4F5IS/c7-13(8,9,10,11)6-3-1-2-5(12)4-6/h1-4H | | InChIKey | OPPXUPGOUVHFHM-UHFFFAOYSA-N | | SMILES | C1(S(F)(F)(F)(F)F)=CC=CC(I)=C1 |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2930909899 |
| | 1-Iodo-3-(pentafluorosulfanyl)benzene Usage And Synthesis |
| | 1-Iodo-3-(pentafluorosulfanyl)benzene Preparation Products And Raw materials |
|