|
|
| | Phenyl sulfur pentafluoride Basic information |
| | Phenyl sulfur pentafluoride Chemical Properties |
| Melting point | -10 °C | | Boiling point | 149 °C | | density | 1.496 g/mL at 25 °C | | refractive index | n20/D 1.435 | | Fp | 43 °C | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C6H5F5S/c7-12(8,9,10,11)6-4-2-1-3-5-6/h1-5H | | InChIKey | DMNYFEWFSFTYEL-UHFFFAOYSA-N | | SMILES | S(C1C=CC=CC=1)(F)(F)(F)(F)F | | CAS DataBase Reference | 2557-81-5 |
| Hazard Codes | Xn | | Risk Statements | 10-22-36/37/38 | | Safety Statements | 26 | | RIDADR | UN 1993 3/PG 3 | | HS Code | 2930909899 |
| | Phenyl sulfur pentafluoride Usage And Synthesis |
| | Phenyl sulfur pentafluoride Preparation Products And Raw materials |
|