|
|
| | 4-CHLORO-2-FLUORO-5-NITROTOLUENE Basic information |
| | 4-CHLORO-2-FLUORO-5-NITROTOLUENE Chemical Properties |
| Melting point | 42-45 °C (lit.) | | Boiling point | 264.3±35.0 °C(Predicted) | | density | 1.417±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Toluene | | form | Crystalline Mass | | color | Yellow to light brown | | InChI | 1S/C7H5ClFNO2/c1-4-2-7(10(11)12)5(8)3-6(4)9/h2-3H,1H3 | | InChIKey | SJDPAVRCQNFVDM-UHFFFAOYSA-N | | SMILES | Cc1cc(c(Cl)cc1F)[N+]([O-])=O | | CAS DataBase Reference | 18349-11-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29049090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-CHLORO-2-FLUORO-5-NITROTOLUENE Usage And Synthesis |
| Uses | 4-Chloro-2-fluoro-5-nitrotoluene may be used in the synthesis of two new C-11 labeled analogs of N,N-dimethyl-2-(2′-amino-4′-hydroxymethyl-phenylthio)benzylamine, which were further evaluated as serotonin transporter imaging agents. |
| | 4-CHLORO-2-FLUORO-5-NITROTOLUENE Preparation Products And Raw materials |
|